C16H26N4O — CID 100837698
(2R)-2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-4-[(1S)-cyclohex-2-en-1-yl]morpholine (PubChem CID 100837698) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is (2R)-2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-4-[(1S)-cyclohex-2-en-1-yl]morpholine.
| Compound Name | (2R)-2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-4-[(1S)-cyclohex-2-en-1-yl]morpholine |
|---|---|
| PubChem CID | 100837698 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2R)-2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)-4-[(1S)-cyclohex-2-en-1-yl]morpholine |
| SMILES | CC(C)(C)c1n[nH]c([C@H]2CN([C@@H]3C=CCCC3)CCO2)n1 |
| InChI | InChI=1S/C16H26N4O/c1-16(2,3)15-17-14(18-19-15)13-11-20(9-10-21-13)12-7-5-4-6-8-12/h5,7,12-13H,4,6,8-11H2,1-3H3,(H,17,18,19)/t12-,13-/m1/s1 |
| InChIKey | KEEHNDSADKQOTQ-CHWSQXEVSA-N |
| XLogP | 2.58 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|