C18H25N3O2 — CID 100838218
N'-(4-methyl-3-pyridinyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxamide (PubChem CID 100838218) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N'-(4-methyl-3-pyridinyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxamide.
| Compound Name | N'-(4-methyl-3-pyridinyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxamide |
|---|---|
| PubChem CID | 100838218 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N'-(4-methyl-3-pyridinyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxamide |
| SMILES | Cc1ccncc1NC(=O)C(=O)N[C@@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C18H25N3O2/c1-11-6-8-19-10-13(11)20-15(22)16(23)21-14-9-12-5-7-18(14,4)17(12,2)3/h6,8,10,12,14H,5,7,9H2,1-4H3,(H,20,22)(H,21,23)/t12-,14-,18-/m1/s1 |
| InChIKey | GKFYCMAGUVZINF-RVZJWNSFSA-N |
| XLogP | 2.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|