C14H26O4 — CID 10083866
(2E,4S,6Z,8R)-9-(methoxymethoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol (PubChem CID 10083866) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2E,4S,6Z,8R)-9-(methoxymethoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol.
| Compound Name | (2E,4S,6Z,8R)-9-(methoxymethoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol |
|---|---|
| PubChem CID | 10083866 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2E,4S,6Z,8R)-9-(methoxymethoxymethoxy)-6,8-dimethylnona-2,6-dien-4-ol |
| SMILES | C/C=C/[C@@H](O)C/C(C)=C\[C@@H](C)COCOCOC |
| InChI | InChI=1S/C14H26O4/c1-5-6-14(15)8-12(2)7-13(3)9-17-11-18-10-16-4/h5-7,13-15H,8-11H2,1-4H3/b6-5+,12-7-/t13-,14-/m1/s1 |
| InChIKey | DQPXNKVNSHFCJC-NDCAZQCESA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|