About (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione
(3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione (PubChem CID 10084008) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione.
Molecular Properties
| Compound Name | (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| PubChem CID | 10084008 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| SMILES | CC(C)[C@H]1OC(=O)[C@@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | YOKBTBNVNCFOBF-CHWSQXEVSA-N |
| XLogP | 1.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione?
The IUPAC name of (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione (CID 10084008) is (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione.
What is the SMILES notation for (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione?
The canonical SMILES for (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione is CC(C)[C@H]1OC(=O)[C@@H](Cc2ccccc2)N(C)C1=O.
What is the InChIKey of (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione?
The InChIKey is YOKBTBNVNCFOBF-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione?
(3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione has a molecular weight of 261.32 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione is sourced from PubChem (CID 10084008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).