C12H22N2O3S — CID 100840455
(2S,3aS,7aS)-1-propylsulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 100840455) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-propylsulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-propylsulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 100840455 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2S,3aS,7aS)-1-propylsulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1[C@H](C(N)=O)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C12H22N2O3S/c1-2-7-18(16,17)14-10-6-4-3-5-9(10)8-11(14)12(13)15/h9-11H,2-8H2,1H3,(H2,13,15)/t9-,10-,11-/m0/s1 |
| InChIKey | MCYZUWUCTLKZFG-DCAQKATOSA-N |
| XLogP | 0.84 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |