C15H18O4 — CID 10084054
(4aR,5R,6R,7S)-6,7-dihydroxy-3,4a,5-trimethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one (PubChem CID 10084054) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4aR,5R,6R,7S)-6,7-dihydroxy-3,4a,5-trimethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (4aR,5R,6R,7S)-6,7-dihydroxy-3,4a,5-trimethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 10084054 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (4aR,5R,6R,7S)-6,7-dihydroxy-3,4a,5-trimethyl-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@@]3(C)C(=C[C@H](O)[C@H](O)[C@@H]3C)C=C2OC1=O |
| InChI | InChI=1S/C15H18O4/c1-7-10-6-15(3)8(2)13(17)11(16)4-9(15)5-12(10)19-14(7)18/h4-5,8,11,13,16-17H,6H2,1-3H3/t8-,11-,13+,15+/m0/s1 |
| InChIKey | AMAJXAHZCGMNST-JPRMETQZSA-N |
| XLogP | 1.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |