C16H22O3 — CID 10084072
methyl (2E,3E,5E)-6,10-dimethyl-2-(2-oxoethylidene)undeca-3,5,9-trienoate (PubChem CID 10084072) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (2E,3E,5E)-6,10-dimethyl-2-(2-oxoethylidene)undeca-3,5,9-trienoate.
| Compound Name | methyl (2E,3E,5E)-6,10-dimethyl-2-(2-oxoethylidene)undeca-3,5,9-trienoate |
|---|---|
| PubChem CID | 10084072 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (2E,3E,5E)-6,10-dimethyl-2-(2-oxoethylidene)undeca-3,5,9-trienoate |
| SMILES | COC(=O)C(/C=C/C=C(\C)CCC=C(C)C)=C/C=O |
| InChI | InChI=1S/C16H22O3/c1-13(2)7-5-8-14(3)9-6-10-15(11-12-17)16(18)19-4/h6-7,9-12H,5,8H2,1-4H3/b10-6+,14-9+,15-11+ |
| InChIKey | OWXUZBBQAHBAKG-KYPPLYASSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|