C8H12N2O6S — CID 10084157
(7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-sulfanylidene-6-oxa-1,3-diazaspiro[4.5]decan-4-one (PubChem CID 10084157) has the molecular formula C8H12N2O6S and a molecular weight of 264.26 g/mol. Its IUPAC name is (7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-sulfanylidene-6-oxa-1,3-diazaspiro[4.5]decan-4-one.
| Compound Name | (7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-sulfanylidene-6-oxa-1,3-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 10084157 |
| Molecular Formula | C8H12N2O6S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (7R,8S,9S,10R)-8,9,10-trihydroxy-7-(hydroxymethyl)-2-sulfanylidene-6-oxa-1,3-diazaspiro[4.5]decan-4-one |
| SMILES | O=C1NC(=S)NC12O[C@H](CO)[C@@H](O)[C@H](O)C2O |
| InChI | InChI=1S/C8H12N2O6S/c11-1-2-3(12)4(13)5(14)8(16-2)6(15)9-7(17)10-8/h2-5,11-14H,1H2,(H2,9,10,15,17)/t2-,3-,4+,5?,8?/m1/s1 |
| InChIKey | OEWLGQKSTDZKFN-XHGXVINMSA-N |
| XLogP | -3.84 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|