C25H28ClN3O3S — CID 100842075
2-[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 100842075) has the molecular formula C25H28ClN3O3S and a molecular weight of 486.04 g/mol. Its IUPAC name is 2-[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 100842075 |
| Molecular Formula | C25H28ClN3O3S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | C[C@@H]1c2[nH]c3ccccc3c2[C@@H](c2ccccc2Cl)CN1CC(=O)N[C@@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H28ClN3O3S/c1-16-24-23(18-8-4-6-10-21(18)27-24)19(17-7-3-5-9-20(17)26)13-29(16)14-22(30)28-25(2)11-12-33(31,32)15-25/h3-10,16,19,27H,11-15H2,1-2H3,(H,28,30)/t16-,19-,25+/m1/s1 |
| InChIKey | LGMZYQFVYJWXRR-JIZVJVNCSA-N |
| XLogP | 4.02 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|