C17H24N4O2 — CID 100842105
(2S)-2-[[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]pentanedinitrile (PubChem CID 100842105) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (2S)-2-[[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]pentanedinitrile.
| Compound Name | (2S)-2-[[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 100842105 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2S)-2-[[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]pentanedinitrile |
| SMILES | C[C@@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(C[C@@H](C#N)CCC#N)C2=O |
| InChI | InChI=1S/C17H24N4O2/c1-12-7-16(2,3)11-17(8-12)14(22)21(15(23)20-17)10-13(9-19)5-4-6-18/h12-13H,4-5,7-8,10-11H2,1-3H3,(H,20,23)/t12-,13-,17+/m1/s1 |
| InChIKey | PIBNPNQMBCENBX-XNJGSVPQSA-N |
| XLogP | 2.57 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|