C20H26N4O3 — CID 100842725
1,3-dimethyl-2,4-dioxo-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 100842725) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 100842725 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cn1c(=O)c2cc(C(=O)N[C@H]3C[C@H]4CC[C@@]3(C)C4(C)C)cnc2n(C)c1=O |
| InChI | InChI=1S/C20H26N4O3/c1-19(2)12-6-7-20(19,3)14(9-12)22-16(25)11-8-13-15(21-10-11)23(4)18(27)24(5)17(13)26/h8,10,12,14H,6-7,9H2,1-5H3,(H,22,25)/t12-,14+,20-/m1/s1 |
| InChIKey | FRQYMCZULOACHJ-TUXXCZFBSA-N |
| XLogP | 1.58 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |