C21H29FN2O2 — CID 100842728
1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-[(2R)-2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]ethanone (PubChem CID 100842728) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-[(2R)-2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-[(2R)-2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 100842728 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-[(2R)-2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC[C@@H]1Cc1cccc(F)c1)N1CCO[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H29FN2O2/c22-17-6-3-5-16(13-17)14-18-7-4-10-23(18)15-21(25)24-11-12-26-20-9-2-1-8-19(20)24/h3,5-6,13,18-20H,1-2,4,7-12,14-15H2/t18-,19+,20-/m1/s1 |
| InChIKey | CNLQBTAGVYGBNO-HSALFYBXSA-N |
| XLogP | 3.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |