About 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane
1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane (PubChem CID 10084296) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane |
| PubChem CID | 10084296 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane |
| SMILES | C=CCOC(C)(C(=C)OCC)C1(C)CCC(C)CC1 |
| InChI | InChI=1S/C17H30O2/c1-7-13-19-17(6,15(4)18-8-2)16(5)11-9-14(3)10-12-16/h7,14H,1,4,8-13H2,2-3,5-6H3 |
| InChIKey | MEECLISRJQURBG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane?
The IUPAC name of 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane (CID 10084296) is 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane.
What is the SMILES notation for 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane?
The canonical SMILES for 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane is C=CCOC(C)(C(=C)OCC)C1(C)CCC(C)CC1.
What is the InChIKey of 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane?
The InChIKey is MEECLISRJQURBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-7-13-19-17(6,15(4)18-8-2)16(5)11-9-14(3)10-12-16/h7,14H,1,4,8-13H2,2-3,5-6H3.
What are the key properties of 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane?
1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane has a molecular weight of 266.42 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-2-prop-2-enoxybut-3-en-2-yl)-1,4-dimethylcyclohexane is sourced from PubChem (CID 10084296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).