About (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol
(1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 100844340) has the molecular formula C16H20F3N3O2
and a molecular weight of 343.35 g/mol. Its IUPAC name is (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol.
Molecular Properties
| Compound Name | (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol |
| PubChem CID | 100844340 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | C[C@H](NC[C@@H](O)c1ccc(OC(F)(F)F)cc1)[C@@H](C)n1cccn1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-11(12(2)22-9-3-8-21-22)20-10-15(23)13-4-6-14(7-5-13)24-16(17,18)19/h3-9,11-12,15,20,23H,10H2,1-2H3/t11-,12+,15+/m0/s1 |
| InChIKey | GJDQWWVCFUPAQJ-YWPYICTPSA-N |
| XLogP | 3.05 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol?
The IUPAC name of (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol (CID 100844340) is (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol.
What is the SMILES notation for (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol?
The canonical SMILES for (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol is C[C@H](NC[C@@H](O)c1ccc(OC(F)(F)F)cc1)[C@@H](C)n1cccn1.
What is the InChIKey of (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol?
The InChIKey is GJDQWWVCFUPAQJ-YWPYICTPSA-N. The full InChI is InChI=1S/C16H20F3N3O2/c1-11(12(2)22-9-3-8-21-22)20-10-15(23)13-4-6-14(7-5-13)24-16(17,18)19/h3-9,11-12,15,20,23H,10H2,1-2H3/t11-,12+,15+/m0/s1.
What are the key properties of (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol?
(1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol has a molecular weight of 343.35 g/mol, XLogP of 3.05, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-[[(2S,3R)-3-pyrazol-1-ylbutan-2-yl]amino]-1-[4-(trifluoromethoxy)phenyl]ethanol is sourced from PubChem (CID 100844340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).