About methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate
methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate (PubChem CID 10084562) has the molecular formula C12H17NO4S
and a molecular weight of 271.34 g/mol. Its IUPAC name is methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate.
Molecular Properties
| Compound Name | methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate |
| PubChem CID | 10084562 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate |
| SMILES | CCOC(=O)/C(C)=C1\NC(C(=O)OC)=C(C)CS1 |
| InChI | InChI=1S/C12H17NO4S/c1-5-17-11(14)8(3)10-13-9(12(15)16-4)7(2)6-18-10/h13H,5-6H2,1-4H3/b10-8+ |
| InChIKey | LXUIDQHGPKIAAR-CSKARUKUSA-N |
| XLogP | 1.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate?
The IUPAC name of methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate (CID 10084562) is methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate.
What is the SMILES notation for methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate?
The canonical SMILES for methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate is CCOC(=O)/C(C)=C1\NC(C(=O)OC)=C(C)CS1.
What is the InChIKey of methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate?
The InChIKey is LXUIDQHGPKIAAR-CSKARUKUSA-N. The full InChI is InChI=1S/C12H17NO4S/c1-5-17-11(14)8(3)10-13-9(12(15)16-4)7(2)6-18-10/h13H,5-6H2,1-4H3/b10-8+.
What are the key properties of methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate?
methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate has a molecular weight of 271.34 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)-5-methyl-3,6-dihydro-1,3-thiazine-4-carboxylate is sourced from PubChem (CID 10084562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).