About 3-amino-6-methyl-10,10-dioxothioxanthen-9-one
3-amino-6-methyl-10,10-dioxothioxanthen-9-one (PubChem CID 10084677) has the molecular formula C14H11NO3S
and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-amino-6-methyl-10,10-dioxothioxanthen-9-one.
Molecular Properties
| Compound Name | 3-amino-6-methyl-10,10-dioxothioxanthen-9-one |
| PubChem CID | 10084677 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-amino-6-methyl-10,10-dioxothioxanthen-9-one |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)c1cc(N)ccc1C2=O |
| InChI | InChI=1S/C14H11NO3S/c1-8-2-4-10-12(6-8)19(17,18)13-7-9(15)3-5-11(13)14(10)16/h2-7H,15H2,1H3 |
| InChIKey | JJURLWAFDIPMCS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6-methyl-10,10-dioxothioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methyl-10,10-dioxothioxanthen-9-one?
The IUPAC name of 3-amino-6-methyl-10,10-dioxothioxanthen-9-one (CID 10084677) is 3-amino-6-methyl-10,10-dioxothioxanthen-9-one.
What is the SMILES notation for 3-amino-6-methyl-10,10-dioxothioxanthen-9-one?
The canonical SMILES for 3-amino-6-methyl-10,10-dioxothioxanthen-9-one is Cc1ccc2c(c1)S(=O)(=O)c1cc(N)ccc1C2=O.
What is the InChIKey of 3-amino-6-methyl-10,10-dioxothioxanthen-9-one?
The InChIKey is JJURLWAFDIPMCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3S/c1-8-2-4-10-12(6-8)19(17,18)13-7-9(15)3-5-11(13)14(10)16/h2-7H,15H2,1H3.
What are the key properties of 3-amino-6-methyl-10,10-dioxothioxanthen-9-one?
3-amino-6-methyl-10,10-dioxothioxanthen-9-one has a molecular weight of 273.31 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methyl-10,10-dioxothioxanthen-9-one is sourced from PubChem (CID 10084677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).