C21H21N3O2 — CID 100847694
[(2S,3R,5R)-3,5-dimethyl-2-phenylmorpholin-4-yl]-quinoxalin-2-ylmethanone (PubChem CID 100847694) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(2S,3R,5R)-3,5-dimethyl-2-phenylmorpholin-4-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [(2S,3R,5R)-3,5-dimethyl-2-phenylmorpholin-4-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 100847694 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(2S,3R,5R)-3,5-dimethyl-2-phenylmorpholin-4-yl]-quinoxalin-2-ylmethanone |
| SMILES | C[C@@H]1CO[C@@H](c2ccccc2)[C@@H](C)N1C(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-13-26-20(16-8-4-3-5-9-16)15(2)24(14)21(25)19-12-22-17-10-6-7-11-18(17)23-19/h3-12,14-15,20H,13H2,1-2H3/t14-,15-,20-/m1/s1 |
| InChIKey | WSCDYOZJOCWCBA-STXHMFSFSA-N |
| XLogP | 3.62 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |