C12H21F3N2O3 — CID 100847824
N-(3-methoxypropyl)-2-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]acetamide (PubChem CID 100847824) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 100847824 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-(3-methoxypropyl)-2-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCC[C@@H]1[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O3/c1-20-7-3-5-16-10(18)8-17-6-2-4-9(17)11(19)12(13,14)15/h9,11,19H,2-8H2,1H3,(H,16,18)/t9-,11-/m1/s1 |
| InChIKey | QWSYGSRHQHSUCU-MWLCHTKSSA-N |
| XLogP | 0.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|