About 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one
9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one (PubChem CID 10084787) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one.
Molecular Properties
| Compound Name | 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one |
| PubChem CID | 10084787 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one |
| SMILES | CC1(C)CC(=O)c2cnc3c(ccc4ccccc43)c2C1 |
| InChI | InChI=1S/C19H17NO/c1-19(2)9-15-14-8-7-12-5-3-4-6-13(12)18(14)20-11-16(15)17(21)10-19/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | ZNMRZYXUWFCOEF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one?
The IUPAC name of 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one (CID 10084787) is 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one.
What is the SMILES notation for 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one?
The canonical SMILES for 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one is CC1(C)CC(=O)c2cnc3c(ccc4ccccc43)c2C1.
What is the InChIKey of 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one?
The InChIKey is ZNMRZYXUWFCOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO/c1-19(2)9-15-14-8-7-12-5-3-4-6-13(12)18(14)20-11-16(15)17(21)10-19/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one?
9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one has a molecular weight of 275.35 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-8,10-dihydrobenzo[c]phenanthridin-7-one is sourced from PubChem (CID 10084787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).