C20H30N2O2 — CID 100849239
N-(4-methylcyclohexyl)-2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]acetamide (PubChem CID 100849239) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 100849239 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-[(2R,6S)-2-methyl-6-phenylmorpholin-4-yl]acetamide |
| SMILES | CC1CCC(NC(=O)CN2C[C@@H](C)O[C@@H](c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-15-8-10-18(11-9-15)21-20(23)14-22-12-16(2)24-19(13-22)17-6-4-3-5-7-17/h3-7,15-16,18-19H,8-14H2,1-2H3,(H,21,23)/t15?,16-,18?,19-/m1/s1 |
| InChIKey | ZQRQKJSPEMSDCS-JGJLBUBWSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |