C15H24N2O2 — CID 100849489
[(2S)-1-[(1S)-cyclohex-2-en-1-yl]pyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 100849489) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2S)-1-[(1S)-cyclohex-2-en-1-yl]pyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S)-1-[(1S)-cyclohex-2-en-1-yl]pyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 100849489 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [(2S)-1-[(1S)-cyclohex-2-en-1-yl]pyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CCCN1[C@@H]1C=CCCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H24N2O2/c18-15(16-9-11-19-12-10-16)14-7-4-8-17(14)13-5-2-1-3-6-13/h2,5,13-14H,1,3-4,6-12H2/t13-,14+/m1/s1 |
| InChIKey | LZBUJNAIISDAGH-KGLIPLIRSA-N |
| XLogP | 1.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|