C18H30O2 — CID 10084972
(5Z,10E,14R)-14-hydroxy-2,6,10-trimethylpentadeca-2,5,10-trien-4-one (PubChem CID 10084972) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5Z,10E,14R)-14-hydroxy-2,6,10-trimethylpentadeca-2,5,10-trien-4-one.
| Compound Name | (5Z,10E,14R)-14-hydroxy-2,6,10-trimethylpentadeca-2,5,10-trien-4-one |
|---|---|
| PubChem CID | 10084972 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (5Z,10E,14R)-14-hydroxy-2,6,10-trimethylpentadeca-2,5,10-trien-4-one |
| SMILES | CC(C)=CC(=O)/C=C(/C)CCC/C(C)=C/CC[C@@H](C)O |
| InChI | InChI=1S/C18H30O2/c1-14(2)12-18(20)13-16(4)10-6-8-15(3)9-7-11-17(5)19/h9,12-13,17,19H,6-8,10-11H2,1-5H3/b15-9+,16-13-/t17-/m1/s1 |
| InChIKey | TZNBCSGCHOVZDX-ZDROHQCRSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|