About 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole
2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (PubChem CID 10085133) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| PubChem CID | 10085133 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| SMILES | Cc1cccc(-c2nn3c(c2-c2ccsc2)CCC3)n1 |
| InChI | InChI=1S/C16H15N3S/c1-11-4-2-5-13(17-11)16-15(12-7-9-20-10-12)14-6-3-8-19(14)18-16/h2,4-5,7,9-10H,3,6,8H2,1H3 |
| InChIKey | APBLBRSNULYQTA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CID 10085133) is 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is Cc1cccc(-c2nn3c(c2-c2ccsc2)CCC3)n1.
What is the InChIKey of 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The InChIKey is APBLBRSNULYQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c1-11-4-2-5-13(17-11)16-15(12-7-9-20-10-12)14-6-3-8-19(14)18-16/h2,4-5,7,9-10H,3,6,8H2,1H3.
What are the key properties of 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole has a molecular weight of 281.38 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2-pyridinyl)-3-thiophen-3-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 10085133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).