C20H24N2O2 — CID 100851447
N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 100851447) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 100851447 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H24N2O2/c23-20(21-18-10-12-22-11-4-3-7-19(18)22)14-24-17-9-8-15-5-1-2-6-16(15)13-17/h1-2,5-6,8-9,13,18-19H,3-4,7,10-12,14H2,(H,21,23)/t18-,19-/m0/s1 |
| InChIKey | HMYVQFWFYVESFR-OALUTQOASA-N |
| XLogP | 2.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |