C18H32N2O3 — CID 100851471
tert-butyl (2R)-2-[[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 100851471) has the molecular formula C18H32N2O3 and a molecular weight of 324.46 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100851471 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl (2R)-2-[[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CN1CCO[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H32N2O3/c1-18(2,3)23-17(21)20-10-6-7-14(20)13-19-11-12-22-16-9-5-4-8-15(16)19/h14-16H,4-13H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | DDHMTADZXYTAQE-OWCLPIDISA-N |
| XLogP | 3.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |