C15H26O3Si — CID 10085205
(3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3a,4,5,6-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 10085205) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3a,4,5,6-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3a,4,5,6-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10085205 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3a,4,5,6-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CC1=C2C(=O)OC[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H26O3Si/c1-10-7-8-12(11-9-17-14(16)13(10)11)18-19(5,6)15(2,3)4/h11-12H,7-9H2,1-6H3/t11-,12+/m1/s1 |
| InChIKey | FVQHHLZFCOJJNX-NEPJUHHUSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|