C21H29NO — CID 100852185
4-[(4aR,6R,6aS,10bR)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]-N,N-dimethylaniline (PubChem CID 100852185) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-[(4aR,6R,6aS,10bR)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(4aR,6R,6aS,10bR)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 100852185 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-[(4aR,6R,6aS,10bR)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H]2O[C@@H]3CCCC[C@@H]3C3=CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H29NO/c1-22(2)16-13-11-15(12-14-16)21-19-9-4-3-7-17(19)18-8-5-6-10-20(18)23-21/h7,11-14,18-21H,3-6,8-10H2,1-2H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | FMGWLRGHPXVIMS-MHTWAQMVSA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|