C16H30N2O3S — CID 100852482
1-[(1S,2R)-2-ethylcyclohexyl]-3-[(1R,3R)-3-methylsulfonylcyclohexyl]urea (PubChem CID 100852482) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is 1-[(1S,2R)-2-ethylcyclohexyl]-3-[(1R,3R)-3-methylsulfonylcyclohexyl]urea.
| Compound Name | 1-[(1S,2R)-2-ethylcyclohexyl]-3-[(1R,3R)-3-methylsulfonylcyclohexyl]urea |
|---|---|
| PubChem CID | 100852482 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-[(1S,2R)-2-ethylcyclohexyl]-3-[(1R,3R)-3-methylsulfonylcyclohexyl]urea |
| SMILES | CC[C@@H]1CCCC[C@@H]1NC(=O)N[C@@H]1CCC[C@@H](S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H30N2O3S/c1-3-12-7-4-5-10-15(12)18-16(19)17-13-8-6-9-14(11-13)22(2,20)21/h12-15H,3-11H2,1-2H3,(H2,17,18,19)/t12-,13-,14-,15+/m1/s1 |
| InChIKey | YSHGMCZABXUACE-TUVASFSCSA-N |
| XLogP | 2.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |