About 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide
3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide (PubChem CID 10085284) has the molecular formula C11H16N4O3S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide |
| PubChem CID | 10085284 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(COc1ccc2nccn2n1)CS(N)(=O)=O |
| InChI | InChI=1S/C11H16N4O3S/c1-11(2,8-19(12,16)17)7-18-10-4-3-9-13-5-6-15(9)14-10/h3-6H,7-8H2,1-2H3,(H2,12,16,17) |
| InChIKey | DGYZELFEVJAOGI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide?
The IUPAC name of 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide (CID 10085284) is 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide.
What is the SMILES notation for 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide?
The canonical SMILES for 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide is CC(C)(COc1ccc2nccn2n1)CS(N)(=O)=O.
What is the InChIKey of 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide?
The InChIKey is DGYZELFEVJAOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3S/c1-11(2,8-19(12,16)17)7-18-10-4-3-9-13-5-6-15(9)14-10/h3-6H,7-8H2,1-2H3,(H2,12,16,17).
What are the key properties of 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide?
3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide has a molecular weight of 284.34 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-b]pyridazin-6-yloxy-2,2-dimethylpropane-1-sulfonamide is sourced from PubChem (CID 10085284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).