C15H20N6 — CID 10085293
1-(6-amino-3-pyridinyl)-3-cyano-2-[(1R,2S,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]guanidine (PubChem CID 10085293) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-3-cyano-2-[(1R,2S,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]guanidine.
| Compound Name | 1-(6-amino-3-pyridinyl)-3-cyano-2-[(1R,2S,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]guanidine |
|---|---|
| PubChem CID | 10085293 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-3-cyano-2-[(1R,2S,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]guanidine |
| SMILES | C[C@]12CC[C@H](C[C@@H]1/N=C(\NC#N)Nc1ccc(N)nc1)C2 |
| InChI | InChI=1S/C15H20N6/c1-15-5-4-10(7-15)6-12(15)21-14(19-9-16)20-11-2-3-13(17)18-8-11/h2-3,8,10,12H,4-7H2,1H3,(H2,17,18)(H2,19,20,21)/t10-,12+,15-/m1/s1 |
| InChIKey | HVFZAVZFLAWYDZ-IFUGULHKSA-N |
| XLogP | 2.08 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|