C14H23NO5 — CID 10085332
methyl (3S,4S,7S,8R,9S,11R)-9-ethoxy-8,11-dimethyl-2,10-dioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate (PubChem CID 10085332) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (3S,4S,7S,8R,9S,11R)-9-ethoxy-8,11-dimethyl-2,10-dioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate.
| Compound Name | methyl (3S,4S,7S,8R,9S,11R)-9-ethoxy-8,11-dimethyl-2,10-dioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
|---|---|
| PubChem CID | 10085332 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | methyl (3S,4S,7S,8R,9S,11R)-9-ethoxy-8,11-dimethyl-2,10-dioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
| SMILES | CCO[C@H]1ON2O[C@H](C(=O)OC)[C@H]3CC[C@@H]([C@H]1C)[C@]32C |
| InChI | InChI=1S/C14H23NO5/c1-5-18-13-8(2)9-6-7-10-11(12(16)17-4)19-15(20-13)14(9,10)3/h8-11,13H,5-7H2,1-4H3/t8-,9+,10-,11+,13+,14-/m1/s1 |
| InChIKey | QLCJECJCFCZTQP-DMDLKNQCSA-N |
| XLogP | 1.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |