About 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione
8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 10085373) has the molecular formula C14H14N4O3
and a molecular weight of 286.29 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 10085373 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C14H14N4O3/c1-17-12-10(13(19)18(2)14(17)20)15-11(16-12)8-4-6-9(21-3)7-5-8/h4-7H,1-3H3,(H,15,16) |
| InChIKey | VPHSVCWZXWNVFF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (CID 10085373) is 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione is COc1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1.
What is the InChIKey of 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is VPHSVCWZXWNVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3/c1-17-12-10(13(19)18(2)14(17)20)15-11(16-12)8-4-6-9(21-3)7-5-8/h4-7H,1-3H3,(H,15,16).
What are the key properties of 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione?
8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 286.29 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-methoxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 10085373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).