About methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate
methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate (PubChem CID 10085557) has the molecular formula C15H15NO5
and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate.
Molecular Properties
| Compound Name | methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate |
| PubChem CID | 10085557 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(NCc2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C15H15NO5/c1-21-15(20)12-7-10(2-4-14(12)19)16-8-9-6-11(17)3-5-13(9)18/h2-7,16-19H,8H2,1H3 |
| InChIKey | NOFICVMLKCZZHJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate?
The IUPAC name of methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate (CID 10085557) is methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate.
What is the SMILES notation for methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate?
The canonical SMILES for methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate is COC(=O)c1cc(NCc2cc(O)ccc2O)ccc1O.
What is the InChIKey of methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate?
The InChIKey is NOFICVMLKCZZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c1-21-15(20)12-7-10(2-4-14(12)19)16-8-9-6-11(17)3-5-13(9)18/h2-7,16-19H,8H2,1H3.
What are the key properties of methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate?
methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate has a molecular weight of 289.29 g/mol, XLogP of 2.20, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,5-dihydroxyphenyl)methylamino]-2-hydroxybenzoate is sourced from PubChem (CID 10085557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).