C23H24N2O — CID 100856193
(2S)-N-naphthalen-1-yl-2-[(3S)-3-phenylpyrrolidin-1-yl]propanamide (PubChem CID 100856193) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-N-naphthalen-1-yl-2-[(3S)-3-phenylpyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-naphthalen-1-yl-2-[(3S)-3-phenylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100856193 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2S)-N-naphthalen-1-yl-2-[(3S)-3-phenylpyrrolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc2ccccc12)N1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H24N2O/c1-17(25-15-14-20(16-25)18-8-3-2-4-9-18)23(26)24-22-13-7-11-19-10-5-6-12-21(19)22/h2-13,17,20H,14-16H2,1H3,(H,24,26)/t17-,20+/m0/s1 |
| InChIKey | RPHWWOWWZLDZEY-FXAWDEMLSA-N |
| XLogP | 4.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |