C11H16O9 — CID 10085697
(2S)-3-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one (PubChem CID 10085697) has the molecular formula C11H16O9 and a molecular weight of 292.24 g/mol. Its IUPAC name is (2S)-3-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one.
| Compound Name | (2S)-3-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
|---|---|
| PubChem CID | 10085697 |
| Molecular Formula | C11H16O9 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (2S)-3-methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
| SMILES | COC1=CC(=O)O[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16O9/c1-17-4-2-6(13)19-10(4)20-11-9(16)8(15)7(14)5(3-12)18-11/h2,5,7-12,14-16H,3H2,1H3/t5-,7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | DCEBSLVJYRBMQI-WIPGOINTSA-N |
| XLogP | -2.78 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |