C18H32OSi — CID 10085747
trimethyl-[2-[[(5R)-3,3,5-trimethyl-4,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-2-yl]methyl]prop-2-enyl]silane (PubChem CID 10085747) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is trimethyl-[2-[[(5R)-3,3,5-trimethyl-4,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-2-yl]methyl]prop-2-enyl]silane.
| Compound Name | trimethyl-[2-[[(5R)-3,3,5-trimethyl-4,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-2-yl]methyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 10085747 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | trimethyl-[2-[[(5R)-3,3,5-trimethyl-4,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-2-yl]methyl]prop-2-enyl]silane |
| SMILES | C=C(CC1OC2=C(CC1(C)C)[C@H](C)CC2)C[Si](C)(C)C |
| InChI | InChI=1S/C18H32OSi/c1-13(12-20(5,6)7)10-17-18(3,4)11-15-14(2)8-9-16(15)19-17/h14,17H,1,8-12H2,2-7H3/t14-,17?/m1/s1 |
| InChIKey | KELIFVFXAZRXMF-XPCCGILXSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|