C17H20N4O — CID 10085928
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-phenylpyrazole-1-carboxamide (PubChem CID 10085928) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-phenylpyrazole-1-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-phenylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 10085928 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-phenylpyrazole-1-carboxamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)n1cc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H20N4O/c22-17(19-16-12-20-8-6-14(16)7-9-20)21-11-15(10-18-21)13-4-2-1-3-5-13/h1-5,10-11,14,16H,6-9,12H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | UALHYGALVLHEQK-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |