C17H19NO2S — CID 10086234
(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine (PubChem CID 10086234) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine.
| Compound Name | (E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine |
|---|---|
| PubChem CID | 10086234 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine |
| SMILES | N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c18-16(12-11-15-7-3-1-4-8-15)13-14-21(19,20)17-9-5-2-6-10-17/h1-10,13-14,16H,11-12,18H2/b14-13+/t16-/m0/s1 |
| InChIKey | ZPXIQFOUPUVVPU-VUSFMPOISA-N |
| XLogP | 2.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |