C19H17NOS — CID 10086551
(2Z)-2-(3-benzyl-1,3-benzothiazol-2-ylidene)cyclopentan-1-one (PubChem CID 10086551) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is (2Z)-2-(3-benzyl-1,3-benzothiazol-2-ylidene)cyclopentan-1-one.
| Compound Name | (2Z)-2-(3-benzyl-1,3-benzothiazol-2-ylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 10086551 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2Z)-2-(3-benzyl-1,3-benzothiazol-2-ylidene)cyclopentan-1-one |
| SMILES | O=C1CCC/C1=C1/Sc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C19H17NOS/c21-17-11-6-9-15(17)19-20(13-14-7-2-1-3-8-14)16-10-4-5-12-18(16)22-19/h1-5,7-8,10,12H,6,9,11,13H2/b19-15- |
| InChIKey | BGBZOHVYBYLFMR-CYVLTUHYSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|