C11H8ClF2N2S+ — CID 10086627
1-chloro-6,7-difluoro-5-methyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium (PubChem CID 10086627) has the molecular formula C11H8ClF2N2S+ and a molecular weight of 273.72 g/mol. Its IUPAC name is 1-chloro-6,7-difluoro-5-methyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium.
| Compound Name | 1-chloro-6,7-difluoro-5-methyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium |
|---|---|
| PubChem CID | 10086627 |
| Molecular Formula | C11H8ClF2N2S+ |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 1-chloro-6,7-difluoro-5-methyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium |
| SMILES | CN1Cc2csc(Cl)[n+]2-c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C11H8ClF2N2S/c1-15-4-6-5-17-11(12)16(6)8-3-2-7(13)9(14)10(8)15/h2-3,5H,4H2,1H3/q+1 |
| InChIKey | IEZZITAPCWNPND-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|