About 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid
2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid (PubChem CID 10086707) has the molecular formula C15H22N2O5
and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid |
| PubChem CID | 10086707 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid |
| SMILES | COC(Cn1c(C2CCCCC2)ncc(C(=O)O)c1=O)OC |
| InChI | InChI=1S/C15H22N2O5/c1-21-12(22-2)9-17-13(10-6-4-3-5-7-10)16-8-11(14(17)18)15(19)20/h8,10,12H,3-7,9H2,1-2H3,(H,19,20) |
| InChIKey | YFFWACDOBFNORI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid?
The IUPAC name of 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid (CID 10086707) is 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid?
The canonical SMILES for 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid is COC(Cn1c(C2CCCCC2)ncc(C(=O)O)c1=O)OC.
What is the InChIKey of 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid?
The InChIKey is YFFWACDOBFNORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O5/c1-21-12(22-2)9-17-13(10-6-4-3-5-7-10)16-8-11(14(17)18)15(19)20/h8,10,12H,3-7,9H2,1-2H3,(H,19,20).
What are the key properties of 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid?
2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid has a molecular weight of 310.35 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid is sourced from PubChem (CID 10086707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).