C22H16Cl2FN3O3 — CID 100867078
(3S,3'aS,8'aS,8'bS)-2'-(2,4-dichlorophenyl)-5-fluorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 100867078) has the molecular formula C22H16Cl2FN3O3 and a molecular weight of 460.29 g/mol. Its IUPAC name is (3S,3'aS,8'aS,8'bS)-2'-(2,4-dichlorophenyl)-5-fluorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aS,8'aS,8'bS)-2'-(2,4-dichlorophenyl)-5-fluorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 100867078 |
| Molecular Formula | C22H16Cl2FN3O3 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (3S,3'aS,8'aS,8'bS)-2'-(2,4-dichlorophenyl)-5-fluorospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | O=C1[C@@H]2[C@@H]3CCCN3[C@@]3(C(=O)Nc4ccc(F)cc43)[C@H]2C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl2FN3O3/c23-10-3-6-15(13(24)8-10)28-19(29)17-16-2-1-7-27(16)22(18(17)20(28)30)12-9-11(25)4-5-14(12)26-21(22)31/h3-6,8-9,16-18H,1-2,7H2,(H,26,31)/t16-,17+,18+,22+/m0/s1 |
| InChIKey | KZUDYHWLXJBKJQ-KCXPTXFHSA-N |
| XLogP | 3.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|