C32H21FN2O3 — CID 100867418
(1S,2R,3aS)-1-benzoyl-7-fluoro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 100867418) has the molecular formula C32H21FN2O3 and a molecular weight of 500.53 g/mol. Its IUPAC name is (1S,2R,3aS)-1-benzoyl-7-fluoro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2R,3aS)-1-benzoyl-7-fluoro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 100867418 |
| Molecular Formula | C32H21FN2O3 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (1S,2R,3aS)-1-benzoyl-7-fluoro-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2cccnc2)C2(C(=O)c3ccccc3C2=O)[C@@H]2C=Cc3cc(F)ccc3N12 |
| InChI | InChI=1S/C32H21FN2O3/c33-22-13-14-25-20(17-22)12-15-26-32(30(37)23-10-4-5-11-24(23)31(32)38)27(21-9-6-16-34-18-21)28(35(25)26)29(36)19-7-2-1-3-8-19/h1-18,26-28H/t26-,27-,28-/m0/s1 |
| InChIKey | QDIGPKQZQDMXSY-KCHLEUMXSA-N |
| XLogP | 5.54 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|