C27H22ClNO2 — CID 100871134
(3aR,4S,7R,7aR)-2-(3-chlorophenyl)-7a-methyl-4,7-diphenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 100871134) has the molecular formula C27H22ClNO2 and a molecular weight of 427.93 g/mol. Its IUPAC name is (3aR,4S,7R,7aR)-2-(3-chlorophenyl)-7a-methyl-4,7-diphenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aR)-2-(3-chlorophenyl)-7a-methyl-4,7-diphenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 100871134 |
| Molecular Formula | C27H22ClNO2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (3aR,4S,7R,7aR)-2-(3-chlorophenyl)-7a-methyl-4,7-diphenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C[C@]12C(=O)N(c3cccc(Cl)c3)C(=O)[C@@H]1[C@@H](c1ccccc1)C=C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C27H22ClNO2/c1-27-23(19-11-6-3-7-12-19)16-15-22(18-9-4-2-5-10-18)24(27)25(30)29(26(27)31)21-14-8-13-20(28)17-21/h2-17,22-24H,1H3/t22-,23-,24+,27-/m1/s1 |
| InChIKey | DHPABJAAWYDUQJ-CHQSNSNVSA-N |
| XLogP | 5.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|