About trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane
trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane (PubChem CID 10087331) has the molecular formula C13H25NO2S2Si
and a molecular weight of 319.57 g/mol. Its IUPAC name is trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane |
| PubChem CID | 10087331 |
| Molecular Formula | C13H25NO2S2Si |
| Molecular Weight | 319.57 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane |
| SMILES | C[Si](C)(C)C1([C@H]2CCCC[C@H]2[N+](=O)[O-])SCCCS1 |
| InChI | InChI=1S/C13H25NO2S2Si/c1-19(2,3)13(17-9-6-10-18-13)11-7-4-5-8-12(11)14(15)16/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | FVOMWXDARIPURJ-NWDGAFQWSA-N |
| XLogP | 4.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane?
The IUPAC name of trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane (CID 10087331) is trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane.
What is the SMILES notation for trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane?
The canonical SMILES for trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane is C[Si](C)(C)C1([C@H]2CCCC[C@H]2[N+](=O)[O-])SCCCS1.
What is the InChIKey of trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane?
The InChIKey is FVOMWXDARIPURJ-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H25NO2S2Si/c1-19(2,3)13(17-9-6-10-18-13)11-7-4-5-8-12(11)14(15)16/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1.
What are the key properties of trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane?
trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane has a molecular weight of 319.57 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[(1S,2R)-2-nitrocyclohexyl]-1,3-dithian-2-yl]silane is sourced from PubChem (CID 10087331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).