C20H36O3 — CID 10087644
(1'R,4R,6R,11'S,12'R)-4,6-dimethylspiro[1,3-dioxane-2,13'-bicyclo[9.3.1]pentadecane]-12'-ol (PubChem CID 10087644) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (1'R,4R,6R,11'S,12'R)-4,6-dimethylspiro[1,3-dioxane-2,13'-bicyclo[9.3.1]pentadecane]-12'-ol.
| Compound Name | (1'R,4R,6R,11'S,12'R)-4,6-dimethylspiro[1,3-dioxane-2,13'-bicyclo[9.3.1]pentadecane]-12'-ol |
|---|---|
| PubChem CID | 10087644 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (1'R,4R,6R,11'S,12'R)-4,6-dimethylspiro[1,3-dioxane-2,13'-bicyclo[9.3.1]pentadecane]-12'-ol |
| SMILES | C[C@@H]1C[C@@H](C)OC2(C[C@@H]3CCCCCCCCC[C@@H](C3)[C@H]2O)O1 |
| InChI | InChI=1S/C20H36O3/c1-15-12-16(2)23-20(22-15)14-17-10-8-6-4-3-5-7-9-11-18(13-17)19(20)21/h15-19,21H,3-14H2,1-2H3/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | GYKQBPBSVLHIKJ-IEWDOMPSSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |