About (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate
(5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate (PubChem CID 10087673) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate |
| PubChem CID | 10087673 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OCc1cnc2c(c1)C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C17H15N3O4/c1-9(2)20-17(23)24-8-10-6-12-14(19-7-10)16(22)13-11(15(12)21)4-3-5-18-13/h3-7,9H,8H2,1-2H3,(H,20,23) |
| InChIKey | KXKUQHADQCKIQT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate?
The IUPAC name of (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate (CID 10087673) is (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate.
What is the SMILES notation for (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate?
The canonical SMILES for (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate is CC(C)NC(=O)OCc1cnc2c(c1)C(=O)c1cccnc1C2=O.
What is the InChIKey of (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate?
The InChIKey is KXKUQHADQCKIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4/c1-9(2)20-17(23)24-8-10-6-12-14(19-7-10)16(22)13-11(15(12)21)4-3-5-18-13/h3-7,9H,8H2,1-2H3,(H,20,23).
What are the key properties of (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate?
(5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate has a molecular weight of 325.32 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-propan-2-ylcarbamate is sourced from PubChem (CID 10087673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).