C19H25NO2S — CID 100878633
(4aR,8aR)-1-(3,4-dihydronaphthalen-2-ylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 100878633) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is (4aR,8aR)-1-(3,4-dihydronaphthalen-2-ylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aR)-1-(3,4-dihydronaphthalen-2-ylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 100878633 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (4aR,8aR)-1-(3,4-dihydronaphthalen-2-ylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(C1=Cc2ccccc2CC1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H25NO2S/c21-23(22,18-12-11-15-6-1-2-8-17(15)14-18)20-13-5-9-16-7-3-4-10-19(16)20/h1-2,6,8,14,16,19H,3-5,7,9-13H2/t16-,19-/m1/s1 |
| InChIKey | VPUBDOWRWJDBFI-VQIMIIECSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |