C17H32O4Si — CID 10087929
2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]ethanone (PubChem CID 10087929) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]ethanone.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]ethanone |
|---|---|
| PubChem CID | 10087929 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]ethanone |
| SMILES | CC(C)=C[C@@H]1OC(C)(C)O[C@@H]1C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-12(2)10-14-15(21-17(6,7)20-14)13(18)11-19-22(8,9)16(3,4)5/h10,14-15H,11H2,1-9H3/t14-,15+/m0/s1 |
| InChIKey | FLVLTKINLRJOGW-LSDHHAIUSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|