C18H18O6 — CID 10088003
[(1R,4E,13R,14S)-14-hydroxy-4-methyl-8-methylidene-3,15-dioxo-2-oxabicyclo[9.3.1]pentadeca-4,11-dien-9-yn-13-yl] acetate (PubChem CID 10088003) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is [(1R,4E,13R,14S)-14-hydroxy-4-methyl-8-methylidene-3,15-dioxo-2-oxabicyclo[9.3.1]pentadeca-4,11-dien-9-yn-13-yl] acetate.
| Compound Name | [(1R,4E,13R,14S)-14-hydroxy-4-methyl-8-methylidene-3,15-dioxo-2-oxabicyclo[9.3.1]pentadeca-4,11-dien-9-yn-13-yl] acetate |
|---|---|
| PubChem CID | 10088003 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(1R,4E,13R,14S)-14-hydroxy-4-methyl-8-methylidene-3,15-dioxo-2-oxabicyclo[9.3.1]pentadeca-4,11-dien-9-yn-13-yl] acetate |
| SMILES | C=C1C#CC2=C[C@@H](OC(C)=O)[C@H](O)[C@@H](OC(=O)/C(C)=C\CC1)C2=O |
| InChI | InChI=1S/C18H18O6/c1-10-5-4-6-11(2)18(22)24-17-15(20)13(8-7-10)9-14(16(17)21)23-12(3)19/h6,9,14,16-17,21H,1,4-5H2,2-3H3/b11-6-/t14-,16+,17+/m1/s1 |
| InChIKey | LIVZJVAYMOEWDJ-AJBXJYGFSA-N |
| XLogP | 1.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|